C13H22N2O5S — CID 129175414
3,3-bis[methyl(2-methylprop-2-enoyl)amino]propane-1-sulfonic acid (PubChem CID 129175414) has the molecular formula C13H22N2O5S and a molecular weight of 318.40 g/mol. Its IUPAC name is 3,3-bis[methyl(2-methylprop-2-enoyl)amino]propane-1-sulfonic acid.
| Compound Name | 3,3-bis[methyl(2-methylprop-2-enoyl)amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 129175414 |
| Molecular Formula | C13H22N2O5S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 3,3-bis[methyl(2-methylprop-2-enoyl)amino]propane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)N(C)C(CCS(=O)(=O)O)N(C)C(=O)C(=C)C |
| InChI | InChI=1S/C13H22N2O5S/c1-9(2)12(16)14(5)11(7-8-21(18,19)20)15(6)13(17)10(3)4/h11H,1,3,7-8H2,2,4-6H3,(H,18,19,20) |
| InChIKey | PIFBABJVVWTAIN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|