C37H56N2O2 — CID 129181410
1-[1-[4-(5-heptanoyl-4,4-dimethyl-2,3-dihydropyridin-1-yl)phenyl]-4,4-dimethyl-2,3-dihydropyridin-5-yl]-3,7-dimethyloct-6-en-1-one (PubChem CID 129181410) has the molecular formula C37H56N2O2 and a molecular weight of 560.87 g/mol. Its IUPAC name is 1-[1-[4-(5-heptanoyl-4,4-dimethyl-2,3-dihydropyridin-1-yl)phenyl]-4,4-dimethyl-2,3-dihydropyridin-5-yl]-3,7-dimethyloct-6-en-1-one.
| Compound Name | 1-[1-[4-(5-heptanoyl-4,4-dimethyl-2,3-dihydropyridin-1-yl)phenyl]-4,4-dimethyl-2,3-dihydropyridin-5-yl]-3,7-dimethyloct-6-en-1-one |
|---|---|
| PubChem CID | 129181410 |
| Molecular Formula | C37H56N2O2 |
| Molecular Weight | 560.87 g/mol |
| Exact Mass | 560.43 |
| IUPAC Name | 1-[1-[4-(5-heptanoyl-4,4-dimethyl-2,3-dihydropyridin-1-yl)phenyl]-4,4-dimethyl-2,3-dihydropyridin-5-yl]-3,7-dimethyloct-6-en-1-one |
| SMILES | CCCCCCC(=O)C1=CN(c2ccc(N3C=C(C(=O)CC(C)CCC=C(C)C)C(C)(C)CC3)cc2)CCC1(C)C |
| InChI | InChI=1S/C37H56N2O2/c1-9-10-11-12-16-34(40)32-26-38(23-21-36(32,5)6)30-17-19-31(20-18-30)39-24-22-37(7,8)33(27-39)35(41)25-29(4)15-13-14-28(2)3/h14,17-20,26-27,29H,9-13,15-16,21-25H2,1-8H3 |
| InChIKey | ZBEVANQUVANMDN-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.87 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|