C19H34INO — CID 166978094
1-(1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-8-iodooctan-1-one (PubChem CID 166978094) has the molecular formula C19H34INO and a molecular weight of 419.39 g/mol. Its IUPAC name is 1-(1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-8-iodooctan-1-one.
| Compound Name | 1-(1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-8-iodooctan-1-one |
|---|---|
| PubChem CID | 166978094 |
| Molecular Formula | C19H34INO |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 1-(1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-8-iodooctan-1-one |
| SMILES | CC1(C)CCN(C(C)(C)C)C=C1C(=O)CCCCCCCI |
| InChI | InChI=1S/C19H34INO/c1-18(2,3)21-14-12-19(4,5)16(15-21)17(22)11-9-7-6-8-10-13-20/h15H,6-14H2,1-5H3 |
| InChIKey | WIAZDCPVUYLCMW-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|