C33H23N3O2 — CID 129183300
5-nitro-1-phenyl-4-(10-phenylphenanthren-4-yl)-2,3-dihydroindazole (PubChem CID 129183300) has the molecular formula C33H23N3O2 and a molecular weight of 493.57 g/mol. Its IUPAC name is 5-nitro-1-phenyl-4-(10-phenylphenanthren-4-yl)-2,3-dihydroindazole.
| Compound Name | 5-nitro-1-phenyl-4-(10-phenylphenanthren-4-yl)-2,3-dihydroindazole |
|---|---|
| PubChem CID | 129183300 |
| Molecular Formula | C33H23N3O2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 5-nitro-1-phenyl-4-(10-phenylphenanthren-4-yl)-2,3-dihydroindazole |
| SMILES | O=[N+]([O-])c1ccc2c(c1-c1cccc3c(-c4ccccc4)cc4ccccc4c13)CNN2c1ccccc1 |
| InChI | InChI=1S/C33H23N3O2/c37-36(38)31-19-18-30-29(21-34-35(30)24-13-5-2-6-14-24)33(31)27-17-9-16-26-28(22-10-3-1-4-11-22)20-23-12-7-8-15-25(23)32(26)27/h1-20,34H,21H2 |
| InChIKey | HICWCRZHJSGLOE-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|