About 1,4-dioxane;2-hydroxybutanedioic acid
1,4-dioxane;2-hydroxybutanedioic acid (PubChem CID 129184976) has the molecular formula C8H14O7
and a molecular weight of 222.19 g/mol. Its IUPAC name is 1,4-dioxane;2-hydroxybutanedioic acid.
Molecular Properties
| Compound Name | 1,4-dioxane;2-hydroxybutanedioic acid |
| PubChem CID | 129184976 |
| Molecular Formula | C8H14O7 |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 1,4-dioxane;2-hydroxybutanedioic acid |
| SMILES | C1COCCO1.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C4H6O5.C4H8O2/c5-2(4(8)9)1-3(6)7;1-2-6-4-3-5-1/h2,5H,1H2,(H,6,7)(H,8,9);1-4H2 |
| InChIKey | OKYYVDUQJANFHU-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,4-dioxane;2-hydroxybutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxane;2-hydroxybutanedioic acid?
The IUPAC name of 1,4-dioxane;2-hydroxybutanedioic acid (CID 129184976) is 1,4-dioxane;2-hydroxybutanedioic acid.
What is the SMILES notation for 1,4-dioxane;2-hydroxybutanedioic acid?
The canonical SMILES for 1,4-dioxane;2-hydroxybutanedioic acid is C1COCCO1.O=C(O)CC(O)C(=O)O.
What is the InChIKey of 1,4-dioxane;2-hydroxybutanedioic acid?
The InChIKey is OKYYVDUQJANFHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O5.C4H8O2/c5-2(4(8)9)1-3(6)7;1-2-6-4-3-5-1/h2,5H,1H2,(H,6,7)(H,8,9);1-4H2.
What are the key properties of 1,4-dioxane;2-hydroxybutanedioic acid?
1,4-dioxane;2-hydroxybutanedioic acid has a molecular weight of 222.19 g/mol, XLogP of -1.06, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxane;2-hydroxybutanedioic acid is sourced from PubChem (CID 129184976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).