C8H14O2 — CID 129194192
3,3-dimethyl-4,5-dihydro-2H-oxepin-7-ol (PubChem CID 129194192) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 3,3-dimethyl-4,5-dihydro-2H-oxepin-7-ol.
| Compound Name | 3,3-dimethyl-4,5-dihydro-2H-oxepin-7-ol |
|---|---|
| PubChem CID | 129194192 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 3,3-dimethyl-4,5-dihydro-2H-oxepin-7-ol |
| SMILES | CC1(C)CCC=C(O)OC1 |
| InChI | InChI=1S/C8H14O2/c1-8(2)5-3-4-7(9)10-6-8/h4,9H,3,5-6H2,1-2H3 |
| InChIKey | OCVBXUAYLDTQEM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |