C15H22F2 — CID 155753878
1-(1,1-difluoroethyl)-3-(5,5-dimethylcyclohexen-1-yl)bicyclo[1.1.1]pentane (PubChem CID 155753878) has the molecular formula C15H22F2 and a molecular weight of 240.34 g/mol. Its IUPAC name is 1-(1,1-difluoroethyl)-3-(5,5-dimethylcyclohexen-1-yl)bicyclo[1.1.1]pentane.
| Compound Name | 1-(1,1-difluoroethyl)-3-(5,5-dimethylcyclohexen-1-yl)bicyclo[1.1.1]pentane |
|---|---|
| PubChem CID | 155753878 |
| Molecular Formula | C15H22F2 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 1-(1,1-difluoroethyl)-3-(5,5-dimethylcyclohexen-1-yl)bicyclo[1.1.1]pentane |
| SMILES | CC1(C)CCC=C(C23CC(C(C)(F)F)(C2)C3)C1 |
| InChI | InChI=1S/C15H22F2/c1-12(2)6-4-5-11(7-12)14-8-15(9-14,10-14)13(3,16)17/h5H,4,6-10H2,1-3H3 |
| InChIKey | JNZAMDHGGVWDLQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|