C7H12OS — CID 134512739
3,3-dimethyl-2,4-dihydropyran-6-thiol (PubChem CID 134512739) has the molecular formula C7H12OS and a molecular weight of 144.24 g/mol. Its IUPAC name is 3,3-dimethyl-2,4-dihydropyran-6-thiol.
| Compound Name | 3,3-dimethyl-2,4-dihydropyran-6-thiol |
|---|---|
| PubChem CID | 134512739 |
| Molecular Formula | C7H12OS |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | 3,3-dimethyl-2,4-dihydropyran-6-thiol |
| SMILES | CC1(C)CC=C(S)OC1 |
| InChI | InChI=1S/C7H12OS/c1-7(2)4-3-6(9)8-5-7/h3,9H,4-5H2,1-2H3 |
| InChIKey | CYRNJQKFBKCFLS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|