C10H9Cl2NO — CID 129195506
2,4-dichloro-7-methoxy-1,2-dihydroquinoline (PubChem CID 129195506) has the molecular formula C10H9Cl2NO and a molecular weight of 230.09 g/mol. Its IUPAC name is 2,4-dichloro-7-methoxy-1,2-dihydroquinoline.
| Compound Name | 2,4-dichloro-7-methoxy-1,2-dihydroquinoline |
|---|---|
| PubChem CID | 129195506 |
| Molecular Formula | C10H9Cl2NO |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 2,4-dichloro-7-methoxy-1,2-dihydroquinoline |
| SMILES | COc1ccc2c(c1)NC(Cl)C=C2Cl |
| InChI | InChI=1S/C10H9Cl2NO/c1-14-6-2-3-7-8(11)5-10(12)13-9(7)4-6/h2-5,10,13H,1H3 |
| InChIKey | CTLQRJIBMBAAHD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|