C30H39NO2 — CID 129197892
(1,2,2,6,6-pentamethylpiperidin-4-yl) 4-(4-cyclohepta-2,4,6-trien-1-ylcyclohex-3-en-1-yl)benzoate (PubChem CID 129197892) has the molecular formula C30H39NO2 and a molecular weight of 445.65 g/mol. Its IUPAC name is (1,2,2,6,6-pentamethylpiperidin-4-yl) 4-(4-cyclohepta-2,4,6-trien-1-ylcyclohex-3-en-1-yl)benzoate.
| Compound Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) 4-(4-cyclohepta-2,4,6-trien-1-ylcyclohex-3-en-1-yl)benzoate |
|---|---|
| PubChem CID | 129197892 |
| Molecular Formula | C30H39NO2 |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.30 |
| IUPAC Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) 4-(4-cyclohepta-2,4,6-trien-1-ylcyclohex-3-en-1-yl)benzoate |
| SMILES | CN1C(C)(C)CC(OC(=O)c2ccc(C3CC=C(C4C=CC=CC=C4)CC3)cc2)CC1(C)C |
| InChI | InChI=1S/C30H39NO2/c1-29(2)20-27(21-30(3,4)31(29)5)33-28(32)26-18-16-25(17-19-26)24-14-12-23(13-15-24)22-10-8-6-7-9-11-22/h6-12,16-19,22,24,27H,13-15,20-21H2,1-5H3 |
| InChIKey | FHGSXRAMDWXOCW-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|