C18H21NO10 — CID 129207141
3-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-hydroxy-2H-furan-5-one (PubChem CID 129207141) has the molecular formula C18H21NO10 and a molecular weight of 411.36 g/mol. Its IUPAC name is 3-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-hydroxy-2H-furan-5-one.
| Compound Name | 3-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-hydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 129207141 |
| Molecular Formula | C18H21NO10 |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 3-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-hydroxy-2H-furan-5-one |
| SMILES | COc1cc(COC2=C(O)C(=O)OC2C2COC(C)(C)O2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H21NO10/c1-18(2)27-8-13(29-18)15-16(14(20)17(21)28-15)26-7-9-5-11(24-3)12(25-4)6-10(9)19(22)23/h5-6,13,15,20H,7-8H2,1-4H3 |
| InChIKey | WELWXSUJFAYQJC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 135.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|