C23H19NO7 — CID 164874654
1-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-8-hydroxy-10H-anthracen-9-one (PubChem CID 164874654) has the molecular formula C23H19NO7 and a molecular weight of 421.41 g/mol. Its IUPAC name is 1-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-8-hydroxy-10H-anthracen-9-one.
| Compound Name | 1-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-8-hydroxy-10H-anthracen-9-one |
|---|---|
| PubChem CID | 164874654 |
| Molecular Formula | C23H19NO7 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 1-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-8-hydroxy-10H-anthracen-9-one |
| SMILES | COc1cc(COc2cccc3c2C(=O)c2c(O)cccc2C3)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C23H19NO7/c1-29-19-10-15(16(24(27)28)11-20(19)30-2)12-31-18-8-4-6-14-9-13-5-3-7-17(25)21(13)23(26)22(14)18/h3-8,10-11,25H,9,12H2,1-2H3 |
| InChIKey | PKANEHXWEKFEDX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|