C9H11F7N2 — CID 129207763
1-(1,1,1,3-tetrafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperazine (PubChem CID 129207763) has the molecular formula C9H11F7N2 and a molecular weight of 280.19 g/mol. Its IUPAC name is 1-(1,1,1,3-tetrafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperazine.
| Compound Name | 1-(1,1,1,3-tetrafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperazine |
|---|---|
| PubChem CID | 129207763 |
| Molecular Formula | C9H11F7N2 |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1-(1,1,1,3-tetrafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperazine |
| SMILES | C=C(F)C(N1CCN(C(F)(F)F)CC1)C(F)(F)F |
| InChI | InChI=1S/C9H11F7N2/c1-6(10)7(8(11,12)13)17-2-4-18(5-3-17)9(14,15)16/h7H,1-5H2 |
| InChIKey | FCUXJUCIACLCNG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|