C17H22N2O2 — CID 129210267
(Z)-7-imino-6-phenyliminoundec-9-enoic acid (PubChem CID 129210267) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is (Z)-7-imino-6-phenyliminoundec-9-enoic acid.
| Compound Name | (Z)-7-imino-6-phenyliminoundec-9-enoic acid |
|---|---|
| PubChem CID | 129210267 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (Z)-7-imino-6-phenyliminoundec-9-enoic acid |
| SMILES | [H]/N=C(C/C=C\C)/C(CCCCC(=O)O)=N/c1ccccc1 |
| InChI | InChI=1S/C17H22N2O2/c1-2-3-11-15(18)16(12-7-8-13-17(20)21)19-14-9-5-4-6-10-14/h2-6,9-10,18H,7-8,11-13H2,1H3,(H,20,21)/b3-2-,18-15+,19-16+ |
| InChIKey | YPLSFSIKOHIAPW-IAOVDZENSA-N |
| XLogP | 4.39 |
| TPSA | 73.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|