C20H17F2NO3S — CID 12922656
4-[bis[(3-fluorophenyl)methyl]amino]benzenesulfonic acid (PubChem CID 12922656) has the molecular formula C20H17F2NO3S and a molecular weight of 389.42 g/mol. Its IUPAC name is 4-[bis[(3-fluorophenyl)methyl]amino]benzenesulfonic acid.
| Compound Name | 4-[bis[(3-fluorophenyl)methyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 12922656 |
| Molecular Formula | C20H17F2NO3S |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 4-[bis[(3-fluorophenyl)methyl]amino]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(N(Cc2cccc(F)c2)Cc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C20H17F2NO3S/c21-17-5-1-3-15(11-17)13-23(14-16-4-2-6-18(22)12-16)19-7-9-20(10-8-19)27(24,25)26/h1-12H,13-14H2,(H,24,25,26) |
| InChIKey | STSNPZFKVZVQSN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|