C9H16F8OP4 — CID 129227890
3,3,4,5,5,6,7,8-octafluoro-4,6,7,8-tetrakis(phosphanyl)nonan-1-ol (PubChem CID 129227890) has the molecular formula C9H16F8OP4 and a molecular weight of 416.11 g/mol. Its IUPAC name is 3,3,4,5,5,6,7,8-octafluoro-4,6,7,8-tetrakis(phosphanyl)nonan-1-ol.
| Compound Name | 3,3,4,5,5,6,7,8-octafluoro-4,6,7,8-tetrakis(phosphanyl)nonan-1-ol |
|---|---|
| PubChem CID | 129227890 |
| Molecular Formula | C9H16F8OP4 |
| Molecular Weight | 416.11 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | 3,3,4,5,5,6,7,8-octafluoro-4,6,7,8-tetrakis(phosphanyl)nonan-1-ol |
| SMILES | CC(F)(P)C(F)(P)C(F)(P)C(F)(F)C(F)(P)C(F)(F)CCO |
| InChI | InChI=1S/C9H16F8OP4/c1-4(10,19)7(15,20)9(17,22)6(13,14)8(16,21)5(11,12)2-3-18/h18H,2-3,19-22H2,1H3 |
| InChIKey | AHXGMDJANAAYIB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.11 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|