C18H21F3N2O4 — CID 129236434
4-(ethenylamino)butyl 4-methoxy-5-(2,2,2-trifluoroethoxy)-1H-indole-3-carboxylate (PubChem CID 129236434) has the molecular formula C18H21F3N2O4 and a molecular weight of 386.37 g/mol. Its IUPAC name is 4-(ethenylamino)butyl 4-methoxy-5-(2,2,2-trifluoroethoxy)-1H-indole-3-carboxylate.
| Compound Name | 4-(ethenylamino)butyl 4-methoxy-5-(2,2,2-trifluoroethoxy)-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 129236434 |
| Molecular Formula | C18H21F3N2O4 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 4-(ethenylamino)butyl 4-methoxy-5-(2,2,2-trifluoroethoxy)-1H-indole-3-carboxylate |
| SMILES | C=CNCCCCOC(=O)c1c[nH]c2ccc(OCC(F)(F)F)c(OC)c12 |
| InChI | InChI=1S/C18H21F3N2O4/c1-3-22-8-4-5-9-26-17(24)12-10-23-13-6-7-14(16(25-2)15(12)13)27-11-18(19,20)21/h3,6-7,10,22-23H,1,4-5,8-9,11H2,2H3 |
| InChIKey | IWINXXALGHIRKE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|