C35H43IN4O8 — CID 129250465
tert-butyl 2-(1,3-dioxoisoindol-2-yl)oxy-2-methyl-3-[4-[1-methyl-6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyridin-1-ium-3-yl]phenoxy]propanoate iodide (PubChem CID 129250465) has the molecular formula C35H43IN4O8 and a molecular weight of 774.65 g/mol. Its IUPAC name is tert-butyl 2-(1,3-dioxoisoindol-2-yl)oxy-2-methyl-3-[4-[1-methyl-6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyridin-1-ium-3-yl]phenoxy]propanoate iodide.
| Compound Name | tert-butyl 2-(1,3-dioxoisoindol-2-yl)oxy-2-methyl-3-[4-[1-methyl-6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyridin-1-ium-3-yl]phenoxy]propanoate iodide |
|---|---|
| PubChem CID | 129250465 |
| Molecular Formula | C35H43IN4O8 |
| Molecular Weight | 774.65 g/mol |
| Exact Mass | 774.21 |
| IUPAC Name | tert-butyl 2-(1,3-dioxoisoindol-2-yl)oxy-2-methyl-3-[4-[1-methyl-6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyridin-1-ium-3-yl]phenoxy]propanoate iodide |
| SMILES | C[n+]1cc(-c2ccc(OCC(C)(ON3C(=O)c4ccccc4C3=O)C(=O)OC(C)(C)C)cc2)ccc1NCCNC(=O)OC(C)(C)C.[I-] |
| InChI | InChI=1S/C35H42N4O8.HI/c1-33(2,3)45-31(42)35(7,47-39-29(40)26-11-9-10-12-27(26)30(39)41)22-44-25-16-13-23(14-17-25)24-15-18-28(38(8)21-24)36-19-20-37-32(43)46-34(4,5)6;/h9-18,21H,19-20,22H2,1-8H3,(H,37,43);1H |
| InChIKey | HMTYPEDJXDRXKS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.65 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|