C18H25NO2S — CID 129257308
tert-butyl 6-butylsulfanyl-3-methylidene-1H-isoindole-2-carboxylate (PubChem CID 129257308) has the molecular formula C18H25NO2S and a molecular weight of 319.47 g/mol. Its IUPAC name is tert-butyl 6-butylsulfanyl-3-methylidene-1H-isoindole-2-carboxylate.
| Compound Name | tert-butyl 6-butylsulfanyl-3-methylidene-1H-isoindole-2-carboxylate |
|---|---|
| PubChem CID | 129257308 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | tert-butyl 6-butylsulfanyl-3-methylidene-1H-isoindole-2-carboxylate |
| SMILES | C=C1c2ccc(SCCCC)cc2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25NO2S/c1-6-7-10-22-15-8-9-16-13(2)19(12-14(16)11-15)17(20)21-18(3,4)5/h8-9,11H,2,6-7,10,12H2,1,3-5H3 |
| InChIKey | WKDUISLCYKFURA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|