C10H12N4 — CID 129287139
N-methyl-4-(methylideneamino)-1,2-dihydro-1,8-naphthyridin-3-amine (PubChem CID 129287139) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is N-methyl-4-(methylideneamino)-1,2-dihydro-1,8-naphthyridin-3-amine.
| Compound Name | N-methyl-4-(methylideneamino)-1,2-dihydro-1,8-naphthyridin-3-amine |
|---|---|
| PubChem CID | 129287139 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | N-methyl-4-(methylideneamino)-1,2-dihydro-1,8-naphthyridin-3-amine |
| SMILES | C=NC1=C(NC)CNc2ncccc21 |
| InChI | InChI=1S/C10H12N4/c1-11-8-6-14-10-7(9(8)12-2)4-3-5-13-10/h3-5,11H,2,6H2,1H3,(H,13,14) |
| InChIKey | JZLJSYBPUOLHAX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|