C22H26N2O4 — CID 129320316
methyl (1R,13R,20S)-13-ethyl-5-methoxy-10-oxa-8,17-diazahexacyclo[11.6.1.01,9.02,7.09,11.017,20]icosa-2(7),3,5,14-tetraene-11-carboxylate (PubChem CID 129320316) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is methyl (1R,13R,20S)-13-ethyl-5-methoxy-10-oxa-8,17-diazahexacyclo[11.6.1.01,9.02,7.09,11.017,20]icosa-2(7),3,5,14-tetraene-11-carboxylate.
| Compound Name | methyl (1R,13R,20S)-13-ethyl-5-methoxy-10-oxa-8,17-diazahexacyclo[11.6.1.01,9.02,7.09,11.017,20]icosa-2(7),3,5,14-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 129320316 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | methyl (1R,13R,20S)-13-ethyl-5-methoxy-10-oxa-8,17-diazahexacyclo[11.6.1.01,9.02,7.09,11.017,20]icosa-2(7),3,5,14-tetraene-11-carboxylate |
| SMILES | CC[C@]12C=CCN3CC[C@@]4(c5ccc(OC)cc5NC45OC5(C(=O)OC)C1)[C@@H]32 |
| InChI | InChI=1S/C22H26N2O4/c1-4-19-8-5-10-24-11-9-20(17(19)24)15-7-6-14(26-2)12-16(15)23-22(20)21(13-19,28-22)18(25)27-3/h5-8,12,17,23H,4,9-11,13H2,1-3H3/t17-,19-,20+,21?,22?/m0/s1 |
| InChIKey | BOHJHCDMBHKGFD-OGQGWYMCSA-N |
| XLogP | 2.44 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|