C8H15F2NO2S — CID 129322266
N-[[(1S)-2,2-difluorocyclohexyl]methyl]methanesulfonamide (PubChem CID 129322266) has the molecular formula C8H15F2NO2S and a molecular weight of 227.28 g/mol. Its IUPAC name is N-[[(1S)-2,2-difluorocyclohexyl]methyl]methanesulfonamide.
| Compound Name | N-[[(1S)-2,2-difluorocyclohexyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 129322266 |
| Molecular Formula | C8H15F2NO2S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | N-[[(1S)-2,2-difluorocyclohexyl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC[C@@H]1CCCCC1(F)F |
| InChI | InChI=1S/C8H15F2NO2S/c1-14(12,13)11-6-7-4-2-3-5-8(7,9)10/h7,11H,2-6H2,1H3/t7-/m0/s1 |
| InChIKey | VZWFKBODRUTDTQ-ZETCQYMHSA-N |
| XLogP | 1.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |