C14H17ClN2O — CID 129364758
(5aR,6R,10aS)-2-chloro-5,5a,6,7,8,9,10,10a-octahydrocyclohepta[b]indole-6-carboxamide (PubChem CID 129364758) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is (5aR,6R,10aS)-2-chloro-5,5a,6,7,8,9,10,10a-octahydrocyclohepta[b]indole-6-carboxamide.
| Compound Name | (5aR,6R,10aS)-2-chloro-5,5a,6,7,8,9,10,10a-octahydrocyclohepta[b]indole-6-carboxamide |
|---|---|
| PubChem CID | 129364758 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (5aR,6R,10aS)-2-chloro-5,5a,6,7,8,9,10,10a-octahydrocyclohepta[b]indole-6-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCC[C@H]2c3cc(Cl)ccc3N[C@@H]12 |
| InChI | InChI=1S/C14H17ClN2O/c15-8-5-6-12-11(7-8)9-3-1-2-4-10(14(16)18)13(9)17-12/h5-7,9-10,13,17H,1-4H2,(H2,16,18)/t9-,10+,13+/m0/s1 |
| InChIKey | SDJMUXXHALBPOA-OPQQBVKSSA-N |
| XLogP | 2.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |