C16H34NO6P — CID 129382691
(2R)-2-[[(1R)-1-[diethoxymethyl(ethoxy)phosphoryl]propyl]amino]-4-methylpentanoic acid (PubChem CID 129382691) has the molecular formula C16H34NO6P and a molecular weight of 367.42 g/mol. Its IUPAC name is (2R)-2-[[(1R)-1-[diethoxymethyl(ethoxy)phosphoryl]propyl]amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[(1R)-1-[diethoxymethyl(ethoxy)phosphoryl]propyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 129382691 |
| Molecular Formula | C16H34NO6P |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (2R)-2-[[(1R)-1-[diethoxymethyl(ethoxy)phosphoryl]propyl]amino]-4-methylpentanoic acid |
| SMILES | CCOC(OCC)[P@@](=O)(OCC)[C@H](CC)N[C@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C16H34NO6P/c1-7-14(17-13(15(18)19)11-12(5)6)24(20,23-10-4)16(21-8-2)22-9-3/h12-14,16-17H,7-11H2,1-6H3,(H,18,19)/t13-,14-,24+/m1/s1 |
| InChIKey | HRYMQBJGKXFEMX-ICBMNTSNSA-N |
| XLogP | 3.48 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|