C15H32N3O6P — CID 57285138
(2S)-6-amino-2-[[(2S)-4-methyl-2-[[(1S)-1-phosphonopropyl]amino]pentanoyl]amino]hexanoic acid (PubChem CID 57285138) has the molecular formula C15H32N3O6P and a molecular weight of 381.41 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-4-methyl-2-[[(1S)-1-phosphonopropyl]amino]pentanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-4-methyl-2-[[(1S)-1-phosphonopropyl]amino]pentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 57285138 |
| Molecular Formula | C15H32N3O6P |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-4-methyl-2-[[(1S)-1-phosphonopropyl]amino]pentanoyl]amino]hexanoic acid |
| SMILES | CC[C@@H](N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C15H32N3O6P/c1-4-13(25(22,23)24)17-12(9-10(2)3)14(19)18-11(15(20)21)7-5-6-8-16/h10-13,17H,4-9,16H2,1-3H3,(H,18,19)(H,20,21)(H2,22,23,24)/t11-,12-,13-/m0/s1 |
| InChIKey | HUIGHHKGEQLZAX-AVGNSLFASA-N |
| XLogP | 0.60 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|