C16H13Cl2N — CID 129404892
(3S)-2,3-dichloro-3-phenyl-4,5-dihydro-1-benzazepine (PubChem CID 129404892) has the molecular formula C16H13Cl2N and a molecular weight of 290.19 g/mol. Its IUPAC name is (3S)-2,3-dichloro-3-phenyl-4,5-dihydro-1-benzazepine.
| Compound Name | (3S)-2,3-dichloro-3-phenyl-4,5-dihydro-1-benzazepine |
|---|---|
| PubChem CID | 129404892 |
| Molecular Formula | C16H13Cl2N |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | (3S)-2,3-dichloro-3-phenyl-4,5-dihydro-1-benzazepine |
| SMILES | ClC1=Nc2ccccc2CC[C@]1(Cl)c1ccccc1 |
| InChI | InChI=1S/C16H13Cl2N/c17-15-16(18,13-7-2-1-3-8-13)11-10-12-6-4-5-9-14(12)19-15/h1-9H,10-11H2/t16-/m0/s1 |
| InChIKey | DANRAPWNYQBERX-INIZCTEOSA-N |
| XLogP | 5.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|