C16H29N3O2S — CID 129433459
1-[(3R)-hex-5-en-3-yl]-3-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methyl]urea (PubChem CID 129433459) has the molecular formula C16H29N3O2S and a molecular weight of 327.49 g/mol. Its IUPAC name is 1-[(3R)-hex-5-en-3-yl]-3-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methyl]urea.
| Compound Name | 1-[(3R)-hex-5-en-3-yl]-3-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methyl]urea |
|---|---|
| PubChem CID | 129433459 |
| Molecular Formula | C16H29N3O2S |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 1-[(3R)-hex-5-en-3-yl]-3-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methyl]urea |
| SMILES | C=CC[C@@H](CC)NC(=O)NC[C@]1(N2CCOCC2)CCSC1 |
| InChI | InChI=1S/C16H29N3O2S/c1-3-5-14(4-2)18-15(20)17-12-16(6-11-22-13-16)19-7-9-21-10-8-19/h3,14H,1,4-13H2,2H3,(H2,17,18,20)/t14-,16-/m1/s1 |
| InChIKey | OPXMRQUXUBHLTL-GDBMZVCRSA-N |
| XLogP | 1.85 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|