C16H21N4O7P — CID 129440867
N-[[(1S)-1-dimethoxyphosphoryl-4-methylcyclohex-3-en-1-yl]methylideneamino]-2,4-dinitroaniline (PubChem CID 129440867) has the molecular formula C16H21N4O7P and a molecular weight of 412.34 g/mol. Its IUPAC name is N-[[(1S)-1-dimethoxyphosphoryl-4-methylcyclohex-3-en-1-yl]methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[[(1S)-1-dimethoxyphosphoryl-4-methylcyclohex-3-en-1-yl]methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 129440867 |
| Molecular Formula | C16H21N4O7P |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[[(1S)-1-dimethoxyphosphoryl-4-methylcyclohex-3-en-1-yl]methylideneamino]-2,4-dinitroaniline |
| SMILES | COP(=O)(OC)[C@]1(C=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC=C(C)CC1 |
| InChI | InChI=1S/C16H21N4O7P/c1-12-6-8-16(9-7-12,28(25,26-2)27-3)11-17-18-14-5-4-13(19(21)22)10-15(14)20(23)24/h4-6,10-11,18H,7-9H2,1-3H3/t16-/m1/s1 |
| InChIKey | WEDUQCXVSSVVPB-MRXNPFEDSA-N |
| XLogP | 4.26 |
| TPSA | 146.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|