C18H28N4O4S — CID 129449341
2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl-methylamino]-N-[[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide (PubChem CID 129449341) has the molecular formula C18H28N4O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl-methylamino]-N-[[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl-methylamino]-N-[[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide |
|---|---|
| PubChem CID | 129449341 |
| Molecular Formula | C18H28N4O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl-methylamino]-N-[[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)N(C)CC(=O)NN=C1C[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C18H28N4O4S/c1-11-16(12(2)26-21-11)27(24,25)22(6)10-15(23)20-19-14-9-13-7-8-18(14,5)17(13,3)4/h13H,7-10H2,1-6H3,(H,20,23)/t13-,18-/m1/s1 |
| InChIKey | OFNOPHGTFFJJTE-FZKQIMNGSA-N |
| XLogP | 2.23 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|