C12H12BrF2NO2S — CID 129451876
2-(3-bromophenyl)sulfanyl-2,2-difluoro-1-morpholin-4-ylethanone (PubChem CID 129451876) has the molecular formula C12H12BrF2NO2S and a molecular weight of 352.20 g/mol. Its IUPAC name is 2-(3-bromophenyl)sulfanyl-2,2-difluoro-1-morpholin-4-ylethanone.
| Compound Name | 2-(3-bromophenyl)sulfanyl-2,2-difluoro-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 129451876 |
| Molecular Formula | C12H12BrF2NO2S |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 2-(3-bromophenyl)sulfanyl-2,2-difluoro-1-morpholin-4-ylethanone |
| SMILES | O=C(N1CCOCC1)C(F)(F)Sc1cccc(Br)c1 |
| InChI | InChI=1S/C12H12BrF2NO2S/c13-9-2-1-3-10(8-9)19-12(14,15)11(17)16-4-6-18-7-5-16/h1-3,8H,4-7H2 |
| InChIKey | QADXFXOFGXMKSL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |