About 2-benzoylpyrido[1,2-b]isoindole-6-carbonitrile
2-benzoylpyrido[1,2-b]isoindole-6-carbonitrile (PubChem CID 12951297) has the molecular formula C20H12N2O
and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-benzoylpyrido[1,2-b]isoindole-6-carbonitrile.
Molecular Properties
| Compound Name | 2-benzoylpyrido[1,2-b]isoindole-6-carbonitrile |
| PubChem CID | 12951297 |
| Molecular Formula | C20H12N2O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-benzoylpyrido[1,2-b]isoindole-6-carbonitrile |
| SMILES | N#Cc1c2ccccc2c2cc(C(=O)c3ccccc3)ccn12 |
| InChI | InChI=1S/C20H12N2O/c21-13-19-17-9-5-4-8-16(17)18-12-15(10-11-22(18)19)20(23)14-6-2-1-3-7-14/h1-12H |
| InChIKey | ICKMVHNXHILKCU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 45.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzoylpyrido[1,2-b]isoindole-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzoylpyrido[1,2-b]isoindole-6-carbonitrile?
The IUPAC name of 2-benzoylpyrido[1,2-b]isoindole-6-carbonitrile (CID 12951297) is 2-benzoylpyrido[1,2-b]isoindole-6-carbonitrile.
What is the SMILES notation for 2-benzoylpyrido[1,2-b]isoindole-6-carbonitrile?
The canonical SMILES for 2-benzoylpyrido[1,2-b]isoindole-6-carbonitrile is N#Cc1c2ccccc2c2cc(C(=O)c3ccccc3)ccn12.
What is the InChIKey of 2-benzoylpyrido[1,2-b]isoindole-6-carbonitrile?
The InChIKey is ICKMVHNXHILKCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12N2O/c21-13-19-17-9-5-4-8-16(17)18-12-15(10-11-22(18)19)20(23)14-6-2-1-3-7-14/h1-12H.
What are the key properties of 2-benzoylpyrido[1,2-b]isoindole-6-carbonitrile?
2-benzoylpyrido[1,2-b]isoindole-6-carbonitrile has a molecular weight of 296.33 g/mol, XLogP of 4.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzoylpyrido[1,2-b]isoindole-6-carbonitrile is sourced from PubChem (CID 12951297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).