C24H23NO3 — CID 12959116
2,2-diphenyl-2-[(2,4,6-trimethylbenzoyl)amino]acetic acid (PubChem CID 12959116) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is 2,2-diphenyl-2-[(2,4,6-trimethylbenzoyl)amino]acetic acid.
| Compound Name | 2,2-diphenyl-2-[(2,4,6-trimethylbenzoyl)amino]acetic acid |
|---|---|
| PubChem CID | 12959116 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 2,2-diphenyl-2-[(2,4,6-trimethylbenzoyl)amino]acetic acid |
| SMILES | Cc1cc(C)c(C(=O)NC(C(=O)O)(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H23NO3/c1-16-14-17(2)21(18(3)15-16)22(26)25-24(23(27)28,19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-15H,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | MAXKTXYKFWRSET-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |