C51H82O2 — CID 129847871
Nonaprenylhydroquinone (PubChem CID 129847871) has the molecular formula C51H82O2 and a molecular weight of 727.20 g/mol. Its IUPAC name is 4-(3-methylbut-2-enoxy)-2,3,3,4,5,5,6,6-octakis(3-methylbut-2-enyl)cyclohexen-1-ol.
| Compound Name | Nonaprenylhydroquinone |
|---|---|
| PubChem CID | 129847871 |
| Molecular Formula | C51H82O2 |
| Molecular Weight | 727.20 g/mol |
| Exact Mass | 726.63 |
| IUPAC Name | 4-(3-methylbut-2-enoxy)-2,3,3,4,5,5,6,6-octakis(3-methylbut-2-enyl)cyclohexen-1-ol |
| SMILES | CC(=CCC1=C(C(C(C(C1(CC=C(C)C)CC=C(C)C)(CC=C(C)C)OCC=C(C)C)(CC=C(C)C)CC=C(C)C)(CC=C(C)C)CC=C(C)C)O)C |
| InChI | InChI=1S/C51H82O2/c1-37(2)19-20-46-47(52)49(31-23-40(7)8,32-24-41(9)10)50(33-25-42(11)12,34-26-43(13)14)51(35-27-44(15)16,53-36-28-45(17)18)48(46,29-21-38(3)4)30-22-39(5)6/h19,21-28,52H,20,29-36H2,1-18H3 |
| InChIKey | IHXIMXXOXHVYMH-UHFFFAOYSA-N |
| XLogP | 16.90 |
| TPSA | 29.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | 1460 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.20 |
| LogP ≤ 5 | 16.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|