C41H66O2 — CID 138393254
4-(3-methylbut-2-enoxy)-3,4,5,5,6,6-hexakis(3-methylbut-2-enyl)cyclohex-2-en-1-ol (PubChem CID 138393254) has the molecular formula C41H66O2 and a molecular weight of 590.98 g/mol. Its IUPAC name is 4-(3-methylbut-2-enoxy)-3,4,5,5,6,6-hexakis(3-methylbut-2-enyl)cyclohex-2-en-1-ol.
| Compound Name | 4-(3-methylbut-2-enoxy)-3,4,5,5,6,6-hexakis(3-methylbut-2-enyl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 138393254 |
| Molecular Formula | C41H66O2 |
| Molecular Weight | 590.98 g/mol |
| Exact Mass | 590.51 |
| IUPAC Name | 4-(3-methylbut-2-enoxy)-3,4,5,5,6,6-hexakis(3-methylbut-2-enyl)cyclohex-2-en-1-ol |
| SMILES | CC(C)=CCOC1(CC=C(C)C)C(CC=C(C)C)=CC(O)C(CC=C(C)C)(CC=C(C)C)C1(CC=C(C)C)CC=C(C)C |
| InChI | InChI=1S/C41H66O2/c1-30(2)15-16-37-29-38(42)39(23-17-31(3)4,24-18-32(5)6)40(25-19-33(7)8,26-20-34(9)10)41(37,27-21-35(11)12)43-28-22-36(13)14/h15,17-22,29,38,42H,16,23-28H2,1-14H3 |
| InChIKey | AOKKDRJQTYISBC-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.98 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|