C8H7ClO2 — CID 130026639
3-chloro-4,5-dimethylcyclohexa-3,5-diene-1,2-dione (PubChem CID 130026639) has the molecular formula C8H7ClO2 and a molecular weight of 170.59 g/mol. Its IUPAC name is 3-chloro-4,5-dimethylcyclohexa-3,5-diene-1,2-dione.
| Compound Name | 3-chloro-4,5-dimethylcyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 130026639 |
| Molecular Formula | C8H7ClO2 |
| Molecular Weight | 170.59 g/mol |
| Exact Mass | 170.01 |
| IUPAC Name | 3-chloro-4,5-dimethylcyclohexa-3,5-diene-1,2-dione |
| SMILES | CC1=CC(=O)C(=O)C(Cl)=C1C |
| InChI | InChI=1S/C8H7ClO2/c1-4-3-6(10)8(11)7(9)5(4)2/h3H,1-2H3 |
| InChIKey | MZRFJELLNFKMKZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.59 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|