C9H7NO2 — CID 86043809
7-methyl-1H-indole-4,5-dione (PubChem CID 86043809) has the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. Its IUPAC name is 7-methyl-1H-indole-4,5-dione.
| Compound Name | 7-methyl-1H-indole-4,5-dione |
|---|---|
| PubChem CID | 86043809 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 7-methyl-1H-indole-4,5-dione |
| SMILES | CC1=CC(=O)C(=O)c2cc[nH]c21 |
| InChI | InChI=1S/C9H7NO2/c1-5-4-7(11)9(12)6-2-3-10-8(5)6/h2-4,10H,1H3 |
| InChIKey | SYKPAXZUBHRKOU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|