C8H9NO4 — CID 130034016
5-methoxy-2-methyl-4-nitrosobenzene-1,3-diol (PubChem CID 130034016) has the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. Its IUPAC name is 5-methoxy-2-methyl-4-nitrosobenzene-1,3-diol.
| Compound Name | 5-methoxy-2-methyl-4-nitrosobenzene-1,3-diol |
|---|---|
| PubChem CID | 130034016 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 5-methoxy-2-methyl-4-nitrosobenzene-1,3-diol |
| SMILES | COc1cc(O)c(C)c(O)c1N=O |
| InChI | InChI=1S/C8H9NO4/c1-4-5(10)3-6(13-2)7(9-12)8(4)11/h3,10-11H,1-2H3 |
| InChIKey | WYIFDAMWOTXVPP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |