About 4-hydroxy-2,3,4,5-tetrahydrofuro[3,4-b]pyran-7-one
4-hydroxy-2,3,4,5-tetrahydrofuro[3,4-b]pyran-7-one (PubChem CID 130123700) has the molecular formula C7H8O4
and a molecular weight of 156.14 g/mol. Its IUPAC name is 4-hydroxy-2,3,4,5-tetrahydrofuro[3,4-b]pyran-7-one.
Analyze 4-hydroxy-2,3,4,5-tetrahydrofuro[3,4-b]pyran-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,3,4,5-tetrahydrofuro[3,4-b]pyran-7-one?
The IUPAC name of 4-hydroxy-2,3,4,5-tetrahydrofuro[3,4-b]pyran-7-one (CID 130123700) is 4-hydroxy-2,3,4,5-tetrahydrofuro[3,4-b]pyran-7-one.
What is the SMILES notation for 4-hydroxy-2,3,4,5-tetrahydrofuro[3,4-b]pyran-7-one?
The canonical SMILES for 4-hydroxy-2,3,4,5-tetrahydrofuro[3,4-b]pyran-7-one is O=C1OCC2=C1OCCC2O.
What is the InChIKey of 4-hydroxy-2,3,4,5-tetrahydrofuro[3,4-b]pyran-7-one?
The InChIKey is BGYVQBVWBNIZSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4/c8-5-1-2-10-6-4(5)3-11-7(6)9/h5,8H,1-3H2.
What are the key properties of 4-hydroxy-2,3,4,5-tetrahydrofuro[3,4-b]pyran-7-one?
4-hydroxy-2,3,4,5-tetrahydrofuro[3,4-b]pyran-7-one has a molecular weight of 156.14 g/mol, XLogP of -0.42, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,3,4,5-tetrahydrofuro[3,4-b]pyran-7-one is sourced from PubChem (CID 130123700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).