C43H43N5 — CID 130180233
2-(4,4a-dihydronaphthalen-1-yl)-4-[3,5-bis(2,6-dimethyl-4-pyridinyl)phenyl]-6-(1,2-dihydronaphthalen-1-yl)-1,3,5-triazinane (PubChem CID 130180233) has the molecular formula C43H43N5 and a molecular weight of 629.85 g/mol. Its IUPAC name is 2-(4,4a-dihydronaphthalen-1-yl)-4-[3,5-bis(2,6-dimethyl-4-pyridinyl)phenyl]-6-(1,2-dihydronaphthalen-1-yl)-1,3,5-triazinane.
| Compound Name | 2-(4,4a-dihydronaphthalen-1-yl)-4-[3,5-bis(2,6-dimethyl-4-pyridinyl)phenyl]-6-(1,2-dihydronaphthalen-1-yl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 130180233 |
| Molecular Formula | C43H43N5 |
| Molecular Weight | 629.85 g/mol |
| Exact Mass | 629.35 |
| IUPAC Name | 2-(4,4a-dihydronaphthalen-1-yl)-4-[3,5-bis(2,6-dimethyl-4-pyridinyl)phenyl]-6-(1,2-dihydronaphthalen-1-yl)-1,3,5-triazinane |
| SMILES | Cc1cc(-c2cc(-c3cc(C)nc(C)c3)cc(C3NC(C4=C5C=CC=CC5CC=C4)NC(C4CC=Cc5ccccc54)N3)c2)cc(C)n1 |
| InChI | InChI=1S/C43H43N5/c1-26-19-32(20-27(2)44-26)34-23-35(33-21-28(3)45-29(4)22-33)25-36(24-34)41-46-42(39-17-9-13-30-11-5-7-15-37(30)39)48-43(47-41)40-18-10-14-31-12-6-8-16-38(31)40/h5-13,15-16,18-25,31,39,41-43,46-48H,14,17H2,1-4H3 |
| InChIKey | SVXQRNYFLKZNDE-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.85 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |