C29H38O2 — CID 130181143
3,7-dimethyloct-6-enyl 5-(4-methylphenyl)-3-phenylhex-5-enoate (PubChem CID 130181143) has the molecular formula C29H38O2 and a molecular weight of 418.62 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl 5-(4-methylphenyl)-3-phenylhex-5-enoate.
| Compound Name | 3,7-dimethyloct-6-enyl 5-(4-methylphenyl)-3-phenylhex-5-enoate |
|---|---|
| PubChem CID | 130181143 |
| Molecular Formula | C29H38O2 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | 3,7-dimethyloct-6-enyl 5-(4-methylphenyl)-3-phenylhex-5-enoate |
| SMILES | C=C(CC(CC(=O)OCCC(C)CCC=C(C)C)c1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H38O2/c1-22(2)10-9-11-23(3)18-19-31-29(30)21-28(27-12-7-6-8-13-27)20-25(5)26-16-14-24(4)15-17-26/h6-8,10,12-17,23,28H,5,9,11,18-21H2,1-4H3 |
| InChIKey | QXBAMEWZJHDTHM-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|