C12H13N5 — CID 130201916
4-N-prop-2-enyl-6-pyridin-2-ylpyrimidine-2,4-diamine (PubChem CID 130201916) has the molecular formula C12H13N5 and a molecular weight of 227.27 g/mol. Its IUPAC name is 4-N-prop-2-enyl-6-pyridin-2-ylpyrimidine-2,4-diamine.
| Compound Name | 4-N-prop-2-enyl-6-pyridin-2-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 130201916 |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 4-N-prop-2-enyl-6-pyridin-2-ylpyrimidine-2,4-diamine |
| SMILES | C=CCNc1cc(-c2ccccn2)nc(N)n1 |
| InChI | InChI=1S/C12H13N5/c1-2-6-15-11-8-10(16-12(13)17-11)9-5-3-4-7-14-9/h2-5,7-8H,1,6H2,(H3,13,15,16,17) |
| InChIKey | MTJOEQGGQWDFLN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|