C16H16F2O2 — CID 130239312
methyl (2E,4Z)-6-(2,4-difluorophenyl)-2,3-dimethylhepta-2,4,6-trienoate (PubChem CID 130239312) has the molecular formula C16H16F2O2 and a molecular weight of 278.30 g/mol. Its IUPAC name is methyl (2E,4Z)-6-(2,4-difluorophenyl)-2,3-dimethylhepta-2,4,6-trienoate.
| Compound Name | methyl (2E,4Z)-6-(2,4-difluorophenyl)-2,3-dimethylhepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 130239312 |
| Molecular Formula | C16H16F2O2 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | methyl (2E,4Z)-6-(2,4-difluorophenyl)-2,3-dimethylhepta-2,4,6-trienoate |
| SMILES | C=C(/C=C\C(C)=C(/C)C(=O)OC)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H16F2O2/c1-10(12(3)16(19)20-4)5-6-11(2)14-8-7-13(17)9-15(14)18/h5-9H,2H2,1,3-4H3/b6-5-,12-10+ |
| InChIKey | NLTJBFDYLDUGNZ-UDMPHVCXSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|