C19H32O3 — CID 130239976
6-butan-2-yl-3-[1-(2-cyclohexylethoxy)ethoxy]-2H-pyran (PubChem CID 130239976) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is 6-butan-2-yl-3-[1-(2-cyclohexylethoxy)ethoxy]-2H-pyran.
| Compound Name | 6-butan-2-yl-3-[1-(2-cyclohexylethoxy)ethoxy]-2H-pyran |
|---|---|
| PubChem CID | 130239976 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 6-butan-2-yl-3-[1-(2-cyclohexylethoxy)ethoxy]-2H-pyran |
| SMILES | CCC(C)C1=CC=C(OC(C)OCCC2CCCCC2)CO1 |
| InChI | InChI=1S/C19H32O3/c1-4-15(2)19-11-10-18(14-21-19)22-16(3)20-13-12-17-8-6-5-7-9-17/h10-11,15-17H,4-9,12-14H2,1-3H3 |
| InChIKey | GDYIYDVDNJENKM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|