C25H38N14 — CID 130243921
4-N,4-N-dimethyl-2-N-[[methyl-[4-(methylamino)-6-[2-(5-methyl-1H-pyrrol-2-yl)ethylamino]-1,3,5-triazin-2-yl]amino]methyl]-2-N-[2-(5-methyl-1H-pyrrol-2-yl)ethyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 130243921) has the molecular formula C25H38N14 and a molecular weight of 534.68 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-2-N-[[methyl-[4-(methylamino)-6-[2-(5-methyl-1H-pyrrol-2-yl)ethylamino]-1,3,5-triazin-2-yl]amino]methyl]-2-N-[2-(5-methyl-1H-pyrrol-2-yl)ethyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,4-N-dimethyl-2-N-[[methyl-[4-(methylamino)-6-[2-(5-methyl-1H-pyrrol-2-yl)ethylamino]-1,3,5-triazin-2-yl]amino]methyl]-2-N-[2-(5-methyl-1H-pyrrol-2-yl)ethyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 130243921 |
| Molecular Formula | C25H38N14 |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.34 |
| IUPAC Name | 4-N,4-N-dimethyl-2-N-[[methyl-[4-(methylamino)-6-[2-(5-methyl-1H-pyrrol-2-yl)ethylamino]-1,3,5-triazin-2-yl]amino]methyl]-2-N-[2-(5-methyl-1H-pyrrol-2-yl)ethyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(NCCc2ccc(C)[nH]2)nc(N(C)CN(CCc2ccc(C)[nH]2)c2nc(N)nc(N(C)C)n2)n1 |
| InChI | InChI=1S/C25H38N14/c1-16-7-9-18(29-16)11-13-28-22-33-21(27-3)34-24(35-22)38(6)15-39(14-12-19-10-8-17(2)30-19)25-32-20(26)31-23(36-25)37(4)5/h7-10,29-30H,11-15H2,1-6H3,(H2,26,31,32,36)(H2,27,28,33,34,35) |
| InChIKey | MOAXKMYWHPSGPS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 168.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|