C18H19ClN4 — CID 130253872
1-(4-chlorophenyl)-5-ethanimidoyl-2-methyl-2,3-dihydro-1,5-benzodiazepin-4-imine (PubChem CID 130253872) has the molecular formula C18H19ClN4 and a molecular weight of 326.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-ethanimidoyl-2-methyl-2,3-dihydro-1,5-benzodiazepin-4-imine.
| Compound Name | 1-(4-chlorophenyl)-5-ethanimidoyl-2-methyl-2,3-dihydro-1,5-benzodiazepin-4-imine |
|---|---|
| PubChem CID | 130253872 |
| Molecular Formula | C18H19ClN4 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 1-(4-chlorophenyl)-5-ethanimidoyl-2-methyl-2,3-dihydro-1,5-benzodiazepin-4-imine |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])CC(C)N(c2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C18H19ClN4/c1-12-11-18(21)23(13(2)20)17-6-4-3-5-16(17)22(12)15-9-7-14(19)8-10-15/h3-10,12,20-21H,11H2,1-2H3/b20-13+,21-18+ |
| InChIKey | SRKDTQWLWYUBMH-NQUFBGNASA-N |
| XLogP | 5.05 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|