C17H15ClN4O — CID 130253992
5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-1,5-benzodiazepin-4-one (PubChem CID 130253992) has the molecular formula C17H15ClN4O and a molecular weight of 326.79 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-1,5-benzodiazepin-4-one.
| Compound Name | 5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-1,5-benzodiazepin-4-one |
|---|---|
| PubChem CID | 130253992 |
| Molecular Formula | C17H15ClN4O |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-1,5-benzodiazepin-4-one |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])CC(=O)N(c2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C17H15ClN4O/c1-11(19)21-14-4-2-3-5-15(14)22(17(23)10-16(21)20)13-8-6-12(18)7-9-13/h2-9,19-20H,10H2,1H3/b19-11+,20-16+ |
| InChIKey | OVZBJFAEPRNWGV-WBVBEWOVSA-N |
| XLogP | 4.19 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|