C21H24ClN7 — CID 130254560
5-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3,4-dihydro-1,5-benzodiazepin-7-yl]-1,2,3,4-tetrahydropyrimidin-2-amine (PubChem CID 130254560) has the molecular formula C21H24ClN7 and a molecular weight of 409.93 g/mol. Its IUPAC name is 5-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3,4-dihydro-1,5-benzodiazepin-7-yl]-1,2,3,4-tetrahydropyrimidin-2-amine.
| Compound Name | 5-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3,4-dihydro-1,5-benzodiazepin-7-yl]-1,2,3,4-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 130254560 |
| Molecular Formula | C21H24ClN7 |
| Molecular Weight | 409.93 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 5-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3,4-dihydro-1,5-benzodiazepin-7-yl]-1,2,3,4-tetrahydropyrimidin-2-amine |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])CCN(c2ccc(Cl)cc2)c2cc(C3=CNC(N)NC3)ccc21 |
| InChI | InChI=1S/C21H24ClN7/c1-13(23)29-18-7-2-14(15-11-26-21(25)27-12-15)10-19(18)28(9-8-20(29)24)17-5-3-16(22)4-6-17/h2-7,10-11,21,23-24,26-27H,8-9,12,25H2,1H3/b23-13+,24-20+ |
| InChIKey | ABWGJQIUPHEKLN-WGHMEBRLSA-N |
| XLogP | 3.44 |
| TPSA | 104.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.93 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|