C15H22FNO4 — CID 130254177
[(1E,3Z)-2-fluorohexa-1,3-dienyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoate (PubChem CID 130254177) has the molecular formula C15H22FNO4 and a molecular weight of 299.34 g/mol. Its IUPAC name is [(1E,3Z)-2-fluorohexa-1,3-dienyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoate.
| Compound Name | [(1E,3Z)-2-fluorohexa-1,3-dienyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoate |
|---|---|
| PubChem CID | 130254177 |
| Molecular Formula | C15H22FNO4 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | [(1E,3Z)-2-fluorohexa-1,3-dienyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoate |
| SMILES | C=C[C@H](NC(=O)OC(C)(C)C)C(=O)O/C=C(F)\C=C/CC |
| InChI | InChI=1S/C15H22FNO4/c1-6-8-9-11(16)10-20-13(18)12(7-2)17-14(19)21-15(3,4)5/h7-10,12H,2,6H2,1,3-5H3,(H,17,19)/b9-8-,11-10+/t12-/m0/s1 |
| InChIKey | DRTQMVPCSVWOKC-LKILQSAUSA-N |
| XLogP | 3.39 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|