C26H29F4NO — CID 130261277
5-[4-[4-[(E)-but-2-enoxy]-2,3-difluorophenyl]-3,3-difluorocyclohexyl]-2-[(E)-pent-3-enyl]pyridine (PubChem CID 130261277) has the molecular formula C26H29F4NO and a molecular weight of 447.52 g/mol. Its IUPAC name is 5-[4-[4-[(E)-but-2-enoxy]-2,3-difluorophenyl]-3,3-difluorocyclohexyl]-2-[(E)-pent-3-enyl]pyridine.
| Compound Name | 5-[4-[4-[(E)-but-2-enoxy]-2,3-difluorophenyl]-3,3-difluorocyclohexyl]-2-[(E)-pent-3-enyl]pyridine |
|---|---|
| PubChem CID | 130261277 |
| Molecular Formula | C26H29F4NO |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 5-[4-[4-[(E)-but-2-enoxy]-2,3-difluorophenyl]-3,3-difluorocyclohexyl]-2-[(E)-pent-3-enyl]pyridine |
| SMILES | C/C=C/CCc1ccc(C2CCC(c3ccc(OC/C=C/C)c(F)c3F)C(F)(F)C2)cn1 |
| InChI | InChI=1S/C26H29F4NO/c1-3-5-7-8-20-11-9-19(17-31-20)18-10-13-22(26(29,30)16-18)21-12-14-23(25(28)24(21)27)32-15-6-4-2/h3-6,9,11-12,14,17-18,22H,7-8,10,13,15-16H2,1-2H3/b5-3+,6-4+ |
| InChIKey | ZPDHWCOTAJNXPD-GGWOSOGESA-N |
| XLogP | 7.51 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|