C4H6O6S — CID 130284035
(5-methyl-2-oxo-1,3-dioxolan-4-yl) hydrogen sulfite (PubChem CID 130284035) has the molecular formula C4H6O6S and a molecular weight of 182.15 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxolan-4-yl) hydrogen sulfite.
| Compound Name | (5-methyl-2-oxo-1,3-dioxolan-4-yl) hydrogen sulfite |
|---|---|
| PubChem CID | 130284035 |
| Molecular Formula | C4H6O6S |
| Molecular Weight | 182.15 g/mol |
| Exact Mass | 181.99 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxolan-4-yl) hydrogen sulfite |
| SMILES | CC1OC(=O)OC1OS(=O)O |
| InChI | InChI=1S/C4H6O6S/c1-2-3(10-11(6)7)9-4(5)8-2/h2-3H,1H3,(H,6,7) |
| InChIKey | PYBUKQGERFOVGM-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.15 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|